C20H38OSi — CID 11674197
(E,3R,4S)-3-methyl-1-tri(propan-2-yl)silyldec-5-en-1-yn-4-ol (PubChem CID 11674197) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is (E,3R,4S)-3-methyl-1-tri(propan-2-yl)silyldec-5-en-1-yn-4-ol.
| Compound Name | (E,3R,4S)-3-methyl-1-tri(propan-2-yl)silyldec-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 11674197 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | (E,3R,4S)-3-methyl-1-tri(propan-2-yl)silyldec-5-en-1-yn-4-ol |
| SMILES | CCCC/C=C/[C@H](O)[C@H](C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H38OSi/c1-9-10-11-12-13-20(21)19(8)14-15-22(16(2)3,17(4)5)18(6)7/h12-13,16-21H,9-11H2,1-8H3/b13-12+/t19-,20+/m1/s1 |
| InChIKey | BWGHGWHJFPPIHG-PVAZVXKLSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|