C30H46OSi — CID 11374361
18-[(E)-1-[tert-butyl(dimethyl)silyl]prop-1-en-2-yl]-19-methylicosa-1,18-dien-4,8,14-triyn-3-ol (PubChem CID 11374361) has the molecular formula C30H46OSi and a molecular weight of 450.78 g/mol. Its IUPAC name is 18-[(E)-1-[tert-butyl(dimethyl)silyl]prop-1-en-2-yl]-19-methylicosa-1,18-dien-4,8,14-triyn-3-ol.
| Compound Name | 18-[(E)-1-[tert-butyl(dimethyl)silyl]prop-1-en-2-yl]-19-methylicosa-1,18-dien-4,8,14-triyn-3-ol |
|---|---|
| PubChem CID | 11374361 |
| Molecular Formula | C30H46OSi |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 18-[(E)-1-[tert-butyl(dimethyl)silyl]prop-1-en-2-yl]-19-methylicosa-1,18-dien-4,8,14-triyn-3-ol |
| SMILES | C=CC(O)C#CCCC#CCCCCC#CCCC(=C(C)C)/C(C)=C/[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H46OSi/c1-10-28(31)23-21-19-17-15-13-11-12-14-16-18-20-22-24-29(26(2)3)27(4)25-32(8,9)30(5,6)7/h10,25,28,31H,1,11-12,14,16-17,19,22,24H2,2-9H3/b27-25+ |
| InChIKey | YNHIYBMXCLQTJQ-IMVLJIQESA-N |
| XLogP | 7.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|