C23H38O2Si — CID 134974572
(2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diyn-1-ol (PubChem CID 134974572) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diyn-1-ol.
| Compound Name | (2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diyn-1-ol |
|---|---|
| PubChem CID | 134974572 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diyn-1-ol |
| SMILES | CCCCCCC/C=C\[C@@H](C#CC#C/C=C/CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38O2Si/c1-7-8-9-10-11-13-16-19-22(20-17-14-12-15-18-21-24)25-26(5,6)23(2,3)4/h15-16,18-19,22,24H,7-11,13,21H2,1-6H3/b18-15+,19-16-/t22-/m0/s1 |
| InChIKey | MXOADNBSNKWDFN-LNBJDYFSSA-N |
| XLogP | 5.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|