C18H28O2Si — CID 134972072
(4E,6S,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dien-2,10-diyn-6-ol (PubChem CID 134972072) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (4E,6S,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dien-2,10-diyn-6-ol.
| Compound Name | (4E,6S,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dien-2,10-diyn-6-ol |
|---|---|
| PubChem CID | 134972072 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (4E,6S,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dien-2,10-diyn-6-ol |
| SMILES | CC#C/C=C/[C@@H](O)C/C=C/C#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H28O2Si/c1-7-8-11-14-17(19)15-12-9-10-13-16-20-21(5,6)18(2,3)4/h9,11-12,14,17,19H,15-16H2,1-6H3/b12-9+,14-11+/t17-/m1/s1 |
| InChIKey | NHXPQJSFWUZPKI-NWJAVDNSSA-N |
| XLogP | 3.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|