C16H28OSi2 — CID 14377973
tert-butyl-dimethyl-[(E)-7-trimethylsilylhept-4-en-2,6-diynoxy]silane (PubChem CID 14377973) has the molecular formula C16H28OSi2 and a molecular weight of 292.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-7-trimethylsilylhept-4-en-2,6-diynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-7-trimethylsilylhept-4-en-2,6-diynoxy]silane |
|---|---|
| PubChem CID | 14377973 |
| Molecular Formula | C16H28OSi2 |
| Molecular Weight | 292.57 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-7-trimethylsilylhept-4-en-2,6-diynoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC#C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H28OSi2/c1-16(2,3)19(7,8)17-14-12-10-9-11-13-15-18(4,5)6/h9,11H,14H2,1-8H3/b11-9+ |
| InChIKey | CLHYRAWNRHPWDJ-PKNBQFBNSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|