C16H30O3Si — CID 11472058
(3S,5S)-10-[tert-butyl(dimethyl)silyl]oxydec-1-en-8-yne-3,5-diol (PubChem CID 11472058) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (3S,5S)-10-[tert-butyl(dimethyl)silyl]oxydec-1-en-8-yne-3,5-diol.
| Compound Name | (3S,5S)-10-[tert-butyl(dimethyl)silyl]oxydec-1-en-8-yne-3,5-diol |
|---|---|
| PubChem CID | 11472058 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (3S,5S)-10-[tert-butyl(dimethyl)silyl]oxydec-1-en-8-yne-3,5-diol |
| SMILES | C=C[C@@H](O)C[C@@H](O)CCC#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-7-14(17)13-15(18)11-9-8-10-12-19-20(5,6)16(2,3)4/h7,14-15,17-18H,1,9,11-13H2,2-6H3/t14-,15+/m1/s1 |
| InChIKey | XZEPEZDQKKLLBA-CABCVRRESA-N |
| XLogP | 3.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|