C9H16O2 — CID 132534592
(3S,5R)-nona-1,8-diene-3,5-diol (PubChem CID 132534592) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (3S,5R)-nona-1,8-diene-3,5-diol.
| Compound Name | (3S,5R)-nona-1,8-diene-3,5-diol |
|---|---|
| PubChem CID | 132534592 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (3S,5R)-nona-1,8-diene-3,5-diol |
| SMILES | C=CCC[C@@H](O)C[C@H](O)C=C |
| InChI | InChI=1S/C9H16O2/c1-3-5-6-9(11)7-8(10)4-2/h3-4,8-11H,1-2,5-7H2/t8-,9-/m1/s1 |
| InChIKey | MFDQNLCCXGCDAB-RKDXNWHRSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|