C11H22O3 — CID 91577196
1-methoxydec-9-ene-3,6-diol (PubChem CID 91577196) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 1-methoxydec-9-ene-3,6-diol.
| Compound Name | 1-methoxydec-9-ene-3,6-diol |
|---|---|
| PubChem CID | 91577196 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 1-methoxydec-9-ene-3,6-diol |
| SMILES | C=CCCC(O)CCC(O)CCOC |
| InChI | InChI=1S/C11H22O3/c1-3-4-5-10(12)6-7-11(13)8-9-14-2/h3,10-13H,1,4-9H2,2H3 |
| InChIKey | SQJJCHDYQYYPDD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|