About 7-methoxyheptane-1,5-diol
7-methoxyheptane-1,5-diol (PubChem CID 57129669) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is 7-methoxyheptane-1,5-diol.
Molecular Properties
| Compound Name | 7-methoxyheptane-1,5-diol |
| PubChem CID | 57129669 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 7-methoxyheptane-1,5-diol |
| SMILES | COCCC(O)CCCCO |
| InChI | InChI=1S/C8H18O3/c1-11-7-5-8(10)4-2-3-6-9/h8-10H,2-7H2,1H3 |
| InChIKey | ZAZUINJICIPDHF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxyheptane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyheptane-1,5-diol?
The IUPAC name of 7-methoxyheptane-1,5-diol (CID 57129669) is 7-methoxyheptane-1,5-diol.
What is the SMILES notation for 7-methoxyheptane-1,5-diol?
The canonical SMILES for 7-methoxyheptane-1,5-diol is COCCC(O)CCCCO.
What is the InChIKey of 7-methoxyheptane-1,5-diol?
The InChIKey is ZAZUINJICIPDHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3/c1-11-7-5-8(10)4-2-3-6-9/h8-10H,2-7H2,1H3.
What are the key properties of 7-methoxyheptane-1,5-diol?
7-methoxyheptane-1,5-diol has a molecular weight of 162.23 g/mol, XLogP of 0.55, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyheptane-1,5-diol is sourced from PubChem (CID 57129669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).