C13H24O2 — CID 10584668
(6R,8R)-trideca-1,12-diene-6,8-diol (PubChem CID 10584668) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (6R,8R)-trideca-1,12-diene-6,8-diol.
| Compound Name | (6R,8R)-trideca-1,12-diene-6,8-diol |
|---|---|
| PubChem CID | 10584668 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (6R,8R)-trideca-1,12-diene-6,8-diol |
| SMILES | C=CCCC[C@@H](O)C[C@H](O)CCCC=C |
| InChI | InChI=1S/C13H24O2/c1-3-5-7-9-12(14)11-13(15)10-8-6-4-2/h3-4,12-15H,1-2,5-11H2/t12-,13-/m1/s1 |
| InChIKey | RPGWIEFLHKFWAP-CHWSQXEVSA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|