About 1-bromooct-7-en-2-ol
1-bromooct-7-en-2-ol (PubChem CID 12003548) has the molecular formula C8H15BrO
and a molecular weight of 207.11 g/mol. Its IUPAC name is 1-bromooct-7-en-2-ol.
Molecular Properties
| Compound Name | 1-bromooct-7-en-2-ol |
| PubChem CID | 12003548 |
| Molecular Formula | C8H15BrO |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 1-bromooct-7-en-2-ol |
| SMILES | C=CCCCCC(O)CBr |
| InChI | InChI=1S/C8H15BrO/c1-2-3-4-5-6-8(10)7-9/h2,8,10H,1,3-7H2 |
| InChIKey | YKRIRAYXFFUHPS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromooct-7-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromooct-7-en-2-ol?
The IUPAC name of 1-bromooct-7-en-2-ol (CID 12003548) is 1-bromooct-7-en-2-ol.
What is the SMILES notation for 1-bromooct-7-en-2-ol?
The canonical SMILES for 1-bromooct-7-en-2-ol is C=CCCCCC(O)CBr.
What is the InChIKey of 1-bromooct-7-en-2-ol?
The InChIKey is YKRIRAYXFFUHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrO/c1-2-3-4-5-6-8(10)7-9/h2,8,10H,1,3-7H2.
What are the key properties of 1-bromooct-7-en-2-ol?
1-bromooct-7-en-2-ol has a molecular weight of 207.11 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromooct-7-en-2-ol is sourced from PubChem (CID 12003548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).