4-hydroxydodec-11-enoic acid

C12H22O3 — CID 139805445

IUPAC4-hydroxydodec-11-enoic acid
SMILESC=CCCCCCCC(O)CCC(=O)O
InChIInChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-11(13)9-10-12(14)15/h2,11,13H,1,3-10H2,(H,14,15)
InChIKeyHKMMBGLJCDPIBM-UHFFFAOYSA-N
MW214.30 g/mol
LogP2.74
Rot. Bonds10

About 4-hydroxydodec-11-enoic acid

4-hydroxydodec-11-enoic acid (PubChem CID 139805445) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 4-hydroxydodec-11-enoic acid.

Molecular Properties

Compound Name4-hydroxydodec-11-enoic acid
PubChem CID139805445
Molecular FormulaC12H22O3
Molecular Weight214.30 g/mol
Exact Mass214.16
IUPAC Name4-hydroxydodec-11-enoic acid
SMILESC=CCCCCCCC(O)CCC(=O)O
InChIInChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-11(13)9-10-12(14)15/h2,11,13H,1,3-10H2,(H,14,15)
InChIKeyHKMMBGLJCDPIBM-UHFFFAOYSA-N
XLogP2.74
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.30
LogP ≤ 52.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-hydroxydodec-11-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxydodec-11-enoic acid?
The IUPAC name of 4-hydroxydodec-11-enoic acid (CID 139805445) is 4-hydroxydodec-11-enoic acid.
What is the SMILES notation for 4-hydroxydodec-11-enoic acid?
The canonical SMILES for 4-hydroxydodec-11-enoic acid is C=CCCCCCCC(O)CCC(=O)O.
What is the InChIKey of 4-hydroxydodec-11-enoic acid?
The InChIKey is HKMMBGLJCDPIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-11(13)9-10-12(14)15/h2,11,13H,1,3-10H2,(H,14,15).
What are the key properties of 4-hydroxydodec-11-enoic acid?
4-hydroxydodec-11-enoic acid has a molecular weight of 214.30 g/mol, XLogP of 2.74, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxydodec-11-enoic acid is sourced from PubChem (CID 139805445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).