C12H24O4 — CID 90020174
4,12-dihydroxydodecanoic acid (PubChem CID 90020174) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4,12-dihydroxydodecanoic acid.
| Compound Name | 4,12-dihydroxydodecanoic acid |
|---|---|
| PubChem CID | 90020174 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4,12-dihydroxydodecanoic acid |
| SMILES | O=C(O)CCC(O)CCCCCCCCO |
| InChI | InChI=1S/C12H24O4/c13-10-6-4-2-1-3-5-7-11(14)8-9-12(15)16/h11,13-14H,1-10H2,(H,15,16) |
| InChIKey | YBWROJROTUDFAX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|