C13H26NO3+ — CID 101276722
2-carboxyethyl-(2-hydroxyoct-7-enyl)-dimethylazanium (PubChem CID 101276722) has the molecular formula C13H26NO3+ and a molecular weight of 244.35 g/mol. Its IUPAC name is 2-carboxyethyl-(2-hydroxyoct-7-enyl)-dimethylazanium.
| Compound Name | 2-carboxyethyl-(2-hydroxyoct-7-enyl)-dimethylazanium |
|---|---|
| PubChem CID | 101276722 |
| Molecular Formula | C13H26NO3+ |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-carboxyethyl-(2-hydroxyoct-7-enyl)-dimethylazanium |
| SMILES | C=CCCCCC(O)C[N+](C)(C)CCC(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-4-5-6-7-8-12(15)11-14(2,3)10-9-13(16)17/h4,12,15H,1,5-11H2,2-3H3/p+1 |
| InChIKey | GMWNLHSCKYYJRN-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|