C15H28OSi2 — CID 71658883
tert-butyl-dimethyl-(6-trimethylsilylhexa-3,5-diynoxy)silane (PubChem CID 71658883) has the molecular formula C15H28OSi2 and a molecular weight of 280.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-(6-trimethylsilylhexa-3,5-diynoxy)silane.
| Compound Name | tert-butyl-dimethyl-(6-trimethylsilylhexa-3,5-diynoxy)silane |
|---|---|
| PubChem CID | 71658883 |
| Molecular Formula | C15H28OSi2 |
| Molecular Weight | 280.56 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | tert-butyl-dimethyl-(6-trimethylsilylhexa-3,5-diynoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H28OSi2/c1-15(2,3)18(7,8)16-13-11-9-10-12-14-17(4,5)6/h11,13H2,1-8H3 |
| InChIKey | VXJSBGIAXCZHSP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|