C11H19BrF2OSi — CID 15222237
(5-bromo-5,5-difluoropent-3-ynoxy)-tert-butyl-dimethylsilane (PubChem CID 15222237) has the molecular formula C11H19BrF2OSi and a molecular weight of 313.26 g/mol. Its IUPAC name is (5-bromo-5,5-difluoropent-3-ynoxy)-tert-butyl-dimethylsilane.
| Compound Name | (5-bromo-5,5-difluoropent-3-ynoxy)-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15222237 |
| Molecular Formula | C11H19BrF2OSi |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (5-bromo-5,5-difluoropent-3-ynoxy)-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC#CC(F)(F)Br |
| InChI | InChI=1S/C11H19BrF2OSi/c1-10(2,3)16(4,5)15-9-7-6-8-11(12,13)14/h7,9H2,1-5H3 |
| InChIKey | XIPJGKJQFWXNIV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|