C16H23IOSi — CID 53355261
tert-butyl-[4-(2-iodophenyl)but-3-ynoxy]-dimethylsilane (PubChem CID 53355261) has the molecular formula C16H23IOSi and a molecular weight of 386.35 g/mol. Its IUPAC name is tert-butyl-[4-(2-iodophenyl)but-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-(2-iodophenyl)but-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 53355261 |
| Molecular Formula | C16H23IOSi |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | tert-butyl-[4-(2-iodophenyl)but-3-ynoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC#Cc1ccccc1I |
| InChI | InChI=1S/C16H23IOSi/c1-16(2,3)19(4,5)18-13-9-8-11-14-10-6-7-12-15(14)17/h6-7,10,12H,9,13H2,1-5H3 |
| InChIKey | VXIFWASCOCHLLR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|