C19H30NOSi+ — CID 11705392
4-(1-but-3-enylpyridin-1-ium-2-yl)but-3-ynoxy-tert-butyl-dimethylsilane (PubChem CID 11705392) has the molecular formula C19H30NOSi+ and a molecular weight of 316.54 g/mol. Its IUPAC name is 4-(1-but-3-enylpyridin-1-ium-2-yl)but-3-ynoxy-tert-butyl-dimethylsilane.
| Compound Name | 4-(1-but-3-enylpyridin-1-ium-2-yl)but-3-ynoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11705392 |
| Molecular Formula | C19H30NOSi+ |
| Molecular Weight | 316.54 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 4-(1-but-3-enylpyridin-1-ium-2-yl)but-3-ynoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC[n+]1ccccc1C#CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30NOSi/c1-7-8-15-20-16-11-9-13-18(20)14-10-12-17-21-22(5,6)19(2,3)4/h7,9,11,13,16H,1,8,12,15,17H2,2-6H3/q+1 |
| InChIKey | CSULRROGZJDQET-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|