C26H43BrF6O5Si2 — CID 157255641
(4-bromo-4,4-difluorobut-2-ynoxy)-tert-butyl-dimethylsilane;5-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropent-3-yn-1-ol;4,4-difluoropent-2-yne-1,5-diol (PubChem CID 157255641) has the molecular formula C26H43BrF6O5Si2 and a molecular weight of 685.69 g/mol. Its IUPAC name is (4-bromo-4,4-difluorobut-2-ynoxy)-tert-butyl-dimethylsilane;5-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropent-3-yn-1-ol;4,4-difluoropent-2-yne-1,5-diol.
| Compound Name | (4-bromo-4,4-difluorobut-2-ynoxy)-tert-butyl-dimethylsilane;5-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropent-3-yn-1-ol;4,4-difluoropent-2-yne-1,5-diol |
|---|---|
| PubChem CID | 157255641 |
| Molecular Formula | C26H43BrF6O5Si2 |
| Molecular Weight | 685.69 g/mol |
| Exact Mass | 684.17 |
| IUPAC Name | (4-bromo-4,4-difluorobut-2-ynoxy)-tert-butyl-dimethylsilane;5-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropent-3-yn-1-ol;4,4-difluoropent-2-yne-1,5-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC(F)(F)Br.CC(C)(C)[Si](C)(C)OCC#CC(F)(F)CO.OCC#CC(F)(F)CO |
| InChI | InChI=1S/C11H20F2O2Si.C10H17BrF2OSi.C5H6F2O2/c1-10(2,3)16(4,5)15-8-6-7-11(12,13)9-14;1-9(2,3)15(4,5)14-8-6-7-10(11,12)13;6-5(7,4-9)2-1-3-8/h14H,8-9H2,1-5H3;8H2,1-5H3;8-9H,3-4H2 |
| InChIKey | AWVZXGPMUYROIA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|