C15H20BrClOSi — CID 155571683
3-(2-bromo-4-chlorophenyl)prop-2-ynoxy-tert-butyl-dimethylsilane (PubChem CID 155571683) has the molecular formula C15H20BrClOSi and a molecular weight of 359.77 g/mol. Its IUPAC name is 3-(2-bromo-4-chlorophenyl)prop-2-ynoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-(2-bromo-4-chlorophenyl)prop-2-ynoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 155571683 |
| Molecular Formula | C15H20BrClOSi |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 3-(2-bromo-4-chlorophenyl)prop-2-ynoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC#Cc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C15H20BrClOSi/c1-15(2,3)19(4,5)18-10-6-7-12-8-9-13(17)11-14(12)16/h8-9,11H,10H2,1-5H3 |
| InChIKey | HMJXVEGMFWCFTO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|