C20H24Br2ClFO2Si — CID 167433936
tert-butyl-[2-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenoxy)ethoxy]-dimethylsilane (PubChem CID 167433936) has the molecular formula C20H24Br2ClFO2Si and a molecular weight of 538.76 g/mol. Its IUPAC name is tert-butyl-[2-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenoxy)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenoxy)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 167433936 |
| Molecular Formula | C20H24Br2ClFO2Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 535.96 |
| IUPAC Name | tert-butyl-[2-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenoxy)ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(Oc1c(Br)cccc1Br)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H24Br2ClFO2Si/c1-20(2,3)27(4,5)25-12-18(14-10-9-13(23)11-17(14)24)26-19-15(21)7-6-8-16(19)22/h6-11,18H,12H2,1-5H3 |
| InChIKey | FCMRELGLSWURNB-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|