C17H29BrO2Si — CID 59315520
[(2R)-2-(4-bromo-2-methylphenyl)-2-ethoxyethoxy]-tert-butyl-dimethylsilane (PubChem CID 59315520) has the molecular formula C17H29BrO2Si and a molecular weight of 373.41 g/mol. Its IUPAC name is [(2R)-2-(4-bromo-2-methylphenyl)-2-ethoxyethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2R)-2-(4-bromo-2-methylphenyl)-2-ethoxyethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 59315520 |
| Molecular Formula | C17H29BrO2Si |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(2R)-2-(4-bromo-2-methylphenyl)-2-ethoxyethoxy]-tert-butyl-dimethylsilane |
| SMILES | CCO[C@@H](CO[Si](C)(C)C(C)(C)C)c1ccc(Br)cc1C |
| InChI | InChI=1S/C17H29BrO2Si/c1-8-19-16(12-20-21(6,7)17(3,4)5)15-10-9-14(18)11-13(15)2/h9-11,16H,8,12H2,1-7H3/t16-/m0/s1 |
| InChIKey | QSIQWHNDZZWIKQ-INIZCTEOSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|