C15H25BrOSi — CID 174100478
2-(2-bromophenyl)propoxy-tert-butyl-dimethylsilane (PubChem CID 174100478) has the molecular formula C15H25BrOSi and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-(2-bromophenyl)propoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-(2-bromophenyl)propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174100478 |
| Molecular Formula | C15H25BrOSi |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(2-bromophenyl)propoxy-tert-butyl-dimethylsilane |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)c1ccccc1Br |
| InChI | InChI=1S/C15H25BrOSi/c1-12(13-9-7-8-10-14(13)16)11-17-18(5,6)15(2,3)4/h7-10,12H,11H2,1-6H3 |
| InChIKey | DZKLYMVOJFKDAM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|