C24H36OSe2Si — CID 10720890
tert-butyl-[(2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butoxy]-dimethylsilane (PubChem CID 10720890) has the molecular formula C24H36OSe2Si and a molecular weight of 526.56 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10720890 |
| Molecular Formula | C24H36OSe2Si |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | tert-butyl-[(2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butoxy]-dimethylsilane |
| SMILES | C[C@H](C([Se]c1ccccc1)[Se]c1ccccc1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H36OSe2Si/c1-19(18-25-28(6,7)24(3,4)5)20(2)23(26-21-14-10-8-11-15-21)27-22-16-12-9-13-17-22/h8-17,19-20,23H,18H2,1-7H3/t19-,20-/m0/s1 |
| InChIKey | GXWCCQCYUBUIJZ-PMACEKPBSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|