C27H45NO2Si2 — CID 163216748
4-[tert-butyl(dimethyl)silyl]oxy-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-N-phenylaniline (PubChem CID 163216748) has the molecular formula C27H45NO2Si2 and a molecular weight of 471.83 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-N-phenylaniline.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 163216748 |
| Molecular Formula | C27H45NO2Si2 |
| Molecular Weight | 471.83 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-N-phenylaniline |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)N(c1ccccc1)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H45NO2Si2/c1-22(21-29-31(8,9)26(2,3)4)28(23-15-13-12-14-16-23)24-17-19-25(20-18-24)30-32(10,11)27(5,6)7/h12-20,22H,21H2,1-11H3 |
| InChIKey | OKAJXORFOVKRRQ-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.83 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|