C17H24BrF3O2Si — CID 177483049
(E)-2-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4,4-trifluoro-1-phenylbut-2-en-1-ol (PubChem CID 177483049) has the molecular formula C17H24BrF3O2Si and a molecular weight of 425.36 g/mol. Its IUPAC name is (E)-2-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4,4-trifluoro-1-phenylbut-2-en-1-ol.
| Compound Name | (E)-2-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4,4-trifluoro-1-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 177483049 |
| Molecular Formula | C17H24BrF3O2Si |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | (E)-2-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4,4-trifluoro-1-phenylbut-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C(=C(\Br)C(O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H24BrF3O2Si/c1-16(2,3)24(4,5)23-11-13(17(19,20)21)14(18)15(22)12-9-7-6-8-10-12/h6-10,15,22H,11H2,1-5H3/b14-13+ |
| InChIKey | XVRSCODCZIUTAW-BUHFOSPRSA-N |
| XLogP | 5.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|