C18H24O2Si — CID 135020528
(1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhexa-2,4-diyn-1-ol (PubChem CID 135020528) has the molecular formula C18H24O2Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhexa-2,4-diyn-1-ol.
| Compound Name | (1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhexa-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 135020528 |
| Molecular Formula | C18H24O2Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhexa-2,4-diyn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC#C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H24O2Si/c1-18(2,3)21(4,5)20-15-11-7-10-14-17(19)16-12-8-6-9-13-16/h6,8-9,12-13,17,19H,15H2,1-5H3/t17-/m0/s1 |
| InChIKey | YRSADBBYUQMSAM-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|