C23H37NO3Si — CID 102079093
(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-2-yn-1-amine (PubChem CID 102079093) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is (1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-2-yn-1-amine.
| Compound Name | (1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 102079093 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-2-yn-1-amine |
| SMILES | C[C@H](N[C@H](C#CCO[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C23H37NO3Si/c1-18(19-13-10-9-11-14-19)24-20(21-17-25-23(5,6)27-21)15-12-16-26-28(7,8)22(2,3)4/h9-11,13-14,18,20-21,24H,16-17H2,1-8H3/t18-,20+,21+/m0/s1 |
| InChIKey | DCMNCVCDPZRTLH-CEWLAPEOSA-N |
| XLogP | 4.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|