C28H38O4Si — CID 11155554
(1S)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-yn-1-ol (PubChem CID 11155554) has the molecular formula C28H38O4Si and a molecular weight of 466.69 g/mol. Its IUPAC name is (1S)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-yn-1-ol.
| Compound Name | (1S)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-yn-1-ol |
|---|---|
| PubChem CID | 11155554 |
| Molecular Formula | C28H38O4Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (1S)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-yn-1-ol |
| SMILES | CC1(C)OC[C@H]([C@@H](O)C#CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H38O4Si/c1-27(2,3)33(23-16-10-8-11-17-23,24-18-12-9-13-19-24)31-21-15-7-6-14-20-25(29)26-22-30-28(4,5)32-26/h8-13,16-19,25-26,29H,6-7,15,21-22H2,1-5H3/t25-,26+/m0/s1 |
| InChIKey | VJIBXBPRSNMFCK-IZZNHLLZSA-N |
| XLogP | 4.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|