C14H10Br2ClFO — CID 166094959
1-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenyl)ethanol (PubChem CID 166094959) has the molecular formula C14H10Br2ClFO and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenyl)ethanol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 166094959 |
| Molecular Formula | C14H10Br2ClFO |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 405.88 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2-(2,6-dibromophenyl)ethanol |
| SMILES | OC(Cc1c(Br)cccc1Br)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H10Br2ClFO/c15-11-2-1-3-12(16)10(11)7-14(19)9-5-4-8(17)6-13(9)18/h1-6,14,19H,7H2 |
| InChIKey | PREMHYGCOVOHAK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |