C14H9Cl2F3O — CID 62964279
2-(2,6-dichlorophenyl)-1-(2,3,4-trifluorophenyl)ethanol (PubChem CID 62964279) has the molecular formula C14H9Cl2F3O and a molecular weight of 321.13 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(2,3,4-trifluorophenyl)ethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(2,3,4-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 62964279 |
| Molecular Formula | C14H9Cl2F3O |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(2,3,4-trifluorophenyl)ethanol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9Cl2F3O/c15-9-2-1-3-10(16)8(9)6-12(20)7-4-5-11(17)14(19)13(7)18/h1-5,12,20H,6H2 |
| InChIKey | JZIYQEHXXIWDIT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|