C13H12ClF3N2O — CID 115832377
2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,3,4-trifluorophenyl)ethanol (PubChem CID 115832377) has the molecular formula C13H12ClF3N2O and a molecular weight of 304.70 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,3,4-trifluorophenyl)ethanol.
| Compound Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,3,4-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 115832377 |
| Molecular Formula | C13H12ClF3N2O |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,3,4-trifluorophenyl)ethanol |
| SMILES | Cc1nn(C)c(Cl)c1CC(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H12ClF3N2O/c1-6-8(13(14)19(2)18-6)5-10(20)7-3-4-9(15)12(17)11(7)16/h3-4,10,20H,5H2,1-2H3 |
| InChIKey | IGLHROOTOMQSHI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|