C13H13Br2ClN2O — CID 115832431
2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,5-dibromophenyl)ethanol (PubChem CID 115832431) has the molecular formula C13H13Br2ClN2O and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,5-dibromophenyl)ethanol.
| Compound Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,5-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 115832431 |
| Molecular Formula | C13H13Br2ClN2O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(2,5-dibromophenyl)ethanol |
| SMILES | Cc1nn(C)c(Cl)c1CC(O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H13Br2ClN2O/c1-7-9(13(16)18(2)17-7)6-12(19)10-5-8(14)3-4-11(10)15/h3-5,12,19H,6H2,1-2H3 |
| InChIKey | JGGVQCQWVJCHFK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |