C12H21F3O4SSi — CID 11187078
[5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-yn-2-yl] methanesulfonate (PubChem CID 11187078) has the molecular formula C12H21F3O4SSi and a molecular weight of 346.44 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-yn-2-yl] methanesulfonate.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-yn-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 11187078 |
| Molecular Formula | C12H21F3O4SSi |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-yn-2-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC(OS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C12H21F3O4SSi/c1-11(2,3)21(5,6)18-9-7-8-10(12(13,14)15)19-20(4,16)17/h10H,9H2,1-6H3 |
| InChIKey | MCWCBCLZZZSJAJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|