C34H66O9S2Si2 — CID 141028440
[6-[tert-butyl(dimethyl)silyl]oxy-1-[6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-2-methylsulfonyloxyoct-4-ynoxy]-7,7-dimethyloct-4-yn-2-yl] methanesulfonate (PubChem CID 141028440) has the molecular formula C34H66O9S2Si2 and a molecular weight of 739.20 g/mol. Its IUPAC name is [6-[tert-butyl(dimethyl)silyl]oxy-1-[6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-2-methylsulfonyloxyoct-4-ynoxy]-7,7-dimethyloct-4-yn-2-yl] methanesulfonate.
| Compound Name | [6-[tert-butyl(dimethyl)silyl]oxy-1-[6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-2-methylsulfonyloxyoct-4-ynoxy]-7,7-dimethyloct-4-yn-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 141028440 |
| Molecular Formula | C34H66O9S2Si2 |
| Molecular Weight | 739.20 g/mol |
| Exact Mass | 738.37 |
| IUPAC Name | [6-[tert-butyl(dimethyl)silyl]oxy-1-[6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-2-methylsulfonyloxyoct-4-ynoxy]-7,7-dimethyloct-4-yn-2-yl] methanesulfonate |
| SMILES | CC(C)(C)C(C#CCC(COCC(CC#CC(O[Si](C)(C)C(C)(C)C)C(C)(C)C)OS(C)(=O)=O)OS(C)(=O)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H66O9S2Si2/c1-31(2,3)29(42-46(15,16)33(7,8)9)23-19-21-27(40-44(13,35)36)25-39-26-28(41-45(14,37)38)22-20-24-30(32(4,5)6)43-47(17,18)34(10,11)12/h27-30H,21-22,25-26H2,1-18H3 |
| InChIKey | LECOVSXTDBRRTA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.20 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|