C23H54O6SSi2 — CID 87794972
5-[tert-butyl(dimethyl)silyl]oxypentan-2-ol;5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl methanesulfonate (PubChem CID 87794972) has the molecular formula C23H54O6SSi2 and a molecular weight of 514.92 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxypentan-2-ol;5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl methanesulfonate.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxypentan-2-ol;5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl methanesulfonate |
|---|---|
| PubChem CID | 87794972 |
| Molecular Formula | C23H54O6SSi2 |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxypentan-2-ol;5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl methanesulfonate |
| SMILES | CC(CCCO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O.CC(O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O4SSi.C11H26O2Si/c1-11(16-17(5,13)14)9-8-10-15-18(6,7)12(2,3)4;1-10(12)8-7-9-13-14(5,6)11(2,3)4/h11H,8-10H2,1-7H3;10,12H,7-9H2,1-6H3 |
| InChIKey | GOYBHGVGOUWION-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|