C9H23NO3SSi — CID 153437849
3-[tert-butyl(dimethyl)silyl]oxypropane-1-sulfonamide (PubChem CID 153437849) has the molecular formula C9H23NO3SSi and a molecular weight of 253.44 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypropane-1-sulfonamide.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 153437849 |
| Molecular Formula | C9H23NO3SSi |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypropane-1-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCS(N)(=O)=O |
| InChI | InChI=1S/C9H23NO3SSi/c1-9(2,3)15(4,5)13-7-6-8-14(10,11)12/h6-8H2,1-5H3,(H2,10,11,12) |
| InChIKey | MWQMYAQEUIIRKV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|