C15H32O4SSi — CID 145359169
[(2S,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-en-2-yl] methanesulfonate (PubChem CID 145359169) has the molecular formula C15H32O4SSi and a molecular weight of 336.57 g/mol. Its IUPAC name is [(2S,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-en-2-yl] methanesulfonate.
| Compound Name | [(2S,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 145359169 |
| Molecular Formula | C15H32O4SSi |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(2S,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-en-2-yl] methanesulfonate |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)C[C@H](C)OS(C)(=O)=O |
| InChI | InChI=1S/C15H32O4SSi/c1-9-14(12-13(2)19-20(6,16)17)10-11-18-21(7,8)15(3,4)5/h9,13-14H,1,10-12H2,2-8H3/t13-,14?/m0/s1 |
| InChIKey | CGWUCMAWCZGIGN-LSLKUGRBSA-N |
| XLogP | 3.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|