C14H31NO3SSi — CID 145359416
(2R,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ene-2-sulfonamide (PubChem CID 145359416) has the molecular formula C14H31NO3SSi and a molecular weight of 321.56 g/mol. Its IUPAC name is (2R,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ene-2-sulfonamide.
| Compound Name | (2R,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 145359416 |
| Molecular Formula | C14H31NO3SSi |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2R,4R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hex-5-ene-2-sulfonamide |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)C[C@@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C14H31NO3SSi/c1-8-13(11-12(2)19(15,16)17)9-10-18-20(6,7)14(3,4)5/h8,12-13H,1,9-11H2,2-7H3,(H2,15,16,17)/t12-,13?/m1/s1 |
| InChIKey | GTOSPFBMZMFOAZ-PZORYLMUSA-N |
| XLogP | 3.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|