C21H46O2Si2 — CID 66552565
tert-butyl-[(2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,3-dimethylpentoxy]-dimethylsilane (PubChem CID 66552565) has the molecular formula C21H46O2Si2 and a molecular weight of 386.77 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,3-dimethylpentoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,3-dimethylpentoxy]-dimethylsilane |
|---|---|
| PubChem CID | 66552565 |
| Molecular Formula | C21H46O2Si2 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | tert-butyl-[(2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,3-dimethylpentoxy]-dimethylsilane |
| SMILES | C=C[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O2Si2/c1-14-21(9,17-23-25(12,13)20(6,7)8)18(2)15-16-22-24(10,11)19(3,4)5/h14,18H,1,15-17H2,2-13H3/t18-,21-/m1/s1 |
| InChIKey | LLXULWMRFFYEPE-WIYYLYMNSA-N |
| XLogP | 7.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|