C21H36O5Si — CID 102081241
dimethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enyl]-2-but-2-ynylpropanedioate (PubChem CID 102081241) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is dimethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enyl]-2-but-2-ynylpropanedioate.
| Compound Name | dimethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enyl]-2-but-2-ynylpropanedioate |
|---|---|
| PubChem CID | 102081241 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | dimethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enyl]-2-but-2-ynylpropanedioate |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)CC(CC#CC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H36O5Si/c1-10-12-14-21(18(22)24-6,19(23)25-7)16-17(11-2)13-15-26-27(8,9)20(3,4)5/h11,17H,2,13-16H2,1,3-9H3 |
| InChIKey | WPTSEPVVWGRHEA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|