C20H32O2Si — CID 10865052
tert-butyl-[(7Z)-11-methoxy-3,3-dimethylundeca-1,7-dien-5,9-diyn-2-yl]oxy-dimethylsilane (PubChem CID 10865052) has the molecular formula C20H32O2Si and a molecular weight of 332.56 g/mol. Its IUPAC name is tert-butyl-[(7Z)-11-methoxy-3,3-dimethylundeca-1,7-dien-5,9-diyn-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(7Z)-11-methoxy-3,3-dimethylundeca-1,7-dien-5,9-diyn-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10865052 |
| Molecular Formula | C20H32O2Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl-[(7Z)-11-methoxy-3,3-dimethylundeca-1,7-dien-5,9-diyn-2-yl]oxy-dimethylsilane |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C(C)(C)CC#C/C=C\C#CCOC |
| InChI | InChI=1S/C20H32O2Si/c1-18(22-23(8,9)19(2,3)4)20(5,6)16-14-12-10-11-13-15-17-21-7/h10-11H,1,16-17H2,2-9H3/b11-10- |
| InChIKey | NIAPWLNEOBHMDO-KHPPLWFESA-N |
| XLogP | 5.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|