C16H27IO3Si — CID 11189381
ethyl 2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-iodo-2-methylpent-4-ynoate (PubChem CID 11189381) has the molecular formula C16H27IO3Si and a molecular weight of 422.38 g/mol. Its IUPAC name is ethyl 2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-iodo-2-methylpent-4-ynoate.
| Compound Name | ethyl 2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-iodo-2-methylpent-4-ynoate |
|---|---|
| PubChem CID | 11189381 |
| Molecular Formula | C16H27IO3Si |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | ethyl 2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-iodo-2-methylpent-4-ynoate |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C(C)(CC#CI)C(=O)OCC |
| InChI | InChI=1S/C16H27IO3Si/c1-9-19-14(18)16(6,11-10-12-17)13(2)20-21(7,8)15(3,4)5/h2,9,11H2,1,3-8H3 |
| InChIKey | UUVWGMBADYAXRH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|