C16H32O4Si — CID 56849813
ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyl-4-methylidenehexanoate (PubChem CID 56849813) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyl-4-methylidenehexanoate.
| Compound Name | ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyl-4-methylidenehexanoate |
|---|---|
| PubChem CID | 56849813 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyl-4-methylidenehexanoate |
| SMILES | C=C(CCO[Si](C)(C)C(C)(C)C)CC(C)(O)C(=O)OCC |
| InChI | InChI=1S/C16H32O4Si/c1-9-19-14(17)16(6,18)12-13(2)10-11-20-21(7,8)15(3,4)5/h18H,2,9-12H2,1,3-8H3 |
| InChIKey | IRYGUGICSZRFQH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|