C30H60O8Si2 — CID 157320752
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylate (PubChem CID 157320752) has the molecular formula C30H60O8Si2 and a molecular weight of 604.97 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 157320752 |
| Molecular Formula | C30H60O8Si2 |
| Molecular Weight | 604.97 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(O)CCC(O[Si](C)(C)C(C)(C)C)CC1.CCOC(=O)C1(O)CCC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/2C15H30O4Si/c2*1-7-18-13(16)15(17)10-8-12(9-11-15)19-20(5,6)14(2,3)4/h2*12,17H,7-11H2,1-6H3 |
| InChIKey | BEDCWZUMHZVNJK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.97 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|