C21H40O5Si — CID 11732131
ethyl (2S,4aR,7R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate (PubChem CID 11732131) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is ethyl (2S,4aR,7R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | ethyl (2S,4aR,7R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 11732131 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | ethyl (2S,4aR,7R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC[C@@H](OCOC)C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C21H40O5Si/c1-8-24-19(22)21-11-9-17(25-15-23-5)13-16(21)14-18(10-12-21)26-27(6,7)20(2,3)4/h16-18H,8-15H2,1-7H3/t16-,17+,18-,21+/m0/s1 |
| InChIKey | XNYHOODZXCXDQS-TWFHAPMSSA-N |
| XLogP | 4.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|