C15H28O5Si — CID 91256092
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethoxycarbonylcyclopentane-1-carboxylic acid (PubChem CID 91256092) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethoxycarbonylcyclopentane-1-carboxylic acid.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethoxycarbonylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 91256092 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethoxycarbonylcyclopentane-1-carboxylic acid |
| SMILES | CCOC(=O)C1C[C@H](O[Si](C)(C)C(C)(C)C)CC1C(=O)O |
| InChI | InChI=1S/C15H28O5Si/c1-7-19-14(18)12-9-10(8-11(12)13(16)17)20-21(5,6)15(2,3)4/h10-12H,7-9H2,1-6H3,(H,16,17)/t10-,11?,12?/m1/s1 |
| InChIKey | KVGLWZWRAFWCFS-VOMCLLRMSA-N |
| XLogP | 3.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|