C18H35NO4Si — CID 154024065
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-[(2E)-2-hydroxyiminopropyl]cyclohexane-1-carboxylate (PubChem CID 154024065) has the molecular formula C18H35NO4Si and a molecular weight of 357.57 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-[(2E)-2-hydroxyiminopropyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-[(2E)-2-hydroxyiminopropyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 154024065 |
| Molecular Formula | C18H35NO4Si |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-[(2E)-2-hydroxyiminopropyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C/C(C)=N/O)CCC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H35NO4Si/c1-8-22-16(20)18(13-14(2)19-21)11-9-15(10-12-18)23-24(6,7)17(3,4)5/h15,21H,8-13H2,1-7H3/b19-14+ |
| InChIKey | JBKVNQOMQTUBEL-XMHGGMMESA-N |
| XLogP | 4.74 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|