C16H34O6Si2 — CID 139989242
diethyl 2,3-dimethyl-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 139989242) has the molecular formula C16H34O6Si2 and a molecular weight of 378.61 g/mol. Its IUPAC name is diethyl 2,3-dimethyl-2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | diethyl 2,3-dimethyl-2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 139989242 |
| Molecular Formula | C16H34O6Si2 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | diethyl 2,3-dimethyl-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | CCOC(=O)C(C)(O[Si](C)(C)C)C(C)(O[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C16H34O6Si2/c1-11-19-13(17)15(3,21-23(5,6)7)16(4,14(18)20-12-2)22-24(8,9)10/h11-12H2,1-10H3 |
| InChIKey | NJDIRSMYSUQYHE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|