C14H23F5O5Si — CID 156761988
3-O-tert-butyl 1-O-ethyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate (PubChem CID 156761988) has the molecular formula C14H23F5O5Si and a molecular weight of 394.41 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate.
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate |
|---|---|
| PubChem CID | 156761988 |
| Molecular Formula | C14H23F5O5Si |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate |
| SMILES | CCOC(=O)C(O[Si](C)(C)C)(C(=O)OC(C)(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H23F5O5Si/c1-8-22-9(20)12(24-25(5,6)7,10(21)23-11(2,3)4)13(15,16)14(17,18)19/h8H2,1-7H3 |
| InChIKey | JTCZKQRYGYKYLO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|